C14H13BrN2O2S2 — CID 107583693
3-[(3-bromo-5-methylphenyl)sulfamoyl]benzenecarbothioamide (PubChem CID 107583693) has the molecular formula C14H13BrN2O2S2 and a molecular weight of 385.31 g/mol. Its IUPAC name is 3-[(3-bromo-5-methylphenyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 3-[(3-bromo-5-methylphenyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107583693 |
| Molecular Formula | C14H13BrN2O2S2 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | 3-[(3-bromo-5-methylphenyl)sulfamoyl]benzenecarbothioamide |
| SMILES | Cc1cc(Br)cc(NS(=O)(=O)c2cccc(C(N)=S)c2)c1 |
| InChI | InChI=1S/C14H13BrN2O2S2/c1-9-5-11(15)8-12(6-9)17-21(18,19)13-4-2-3-10(7-13)14(16)20/h2-8,17H,1H3,(H2,16,20) |
| InChIKey | QOZKRXCKGFTWTF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|