C20H23NO2STe — CID 71664020
4-butyltellanyl-1-(4-methylphenyl)sulfonyl-2H-quinoline (PubChem CID 71664020) has the molecular formula C20H23NO2STe and a molecular weight of 469.08 g/mol. Its IUPAC name is 4-butyltellanyl-1-(4-methylphenyl)sulfonyl-2H-quinoline.
| Compound Name | 4-butyltellanyl-1-(4-methylphenyl)sulfonyl-2H-quinoline |
|---|---|
| PubChem CID | 71664020 |
| Molecular Formula | C20H23NO2STe |
| Molecular Weight | 469.08 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 4-butyltellanyl-1-(4-methylphenyl)sulfonyl-2H-quinoline |
| SMILES | CCCC[Te]C1=CCN(S(=O)(=O)c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C20H23NO2STe/c1-3-4-15-25-20-13-14-21(19-8-6-5-7-18(19)20)24(22,23)17-11-9-16(2)10-12-17/h5-13H,3-4,14-15H2,1-2H3 |
| InChIKey | PWKHFMVBCKGWCW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.08 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|