C19H20N2O3S3 — CID 20756530
4-[[6-tert-butyl-5-(hydroxydisulfanyl)-2,3-dihydroindol-1-yl]sulfonyl]benzonitrile (PubChem CID 20756530) has the molecular formula C19H20N2O3S3 and a molecular weight of 420.58 g/mol. Its IUPAC name is 4-[[6-tert-butyl-5-(hydroxydisulfanyl)-2,3-dihydroindol-1-yl]sulfonyl]benzonitrile.
| Compound Name | 4-[[6-tert-butyl-5-(hydroxydisulfanyl)-2,3-dihydroindol-1-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 20756530 |
| Molecular Formula | C19H20N2O3S3 |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 4-[[6-tert-butyl-5-(hydroxydisulfanyl)-2,3-dihydroindol-1-yl]sulfonyl]benzonitrile |
| SMILES | CC(C)(C)c1cc2c(cc1SSO)CCN2S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H20N2O3S3/c1-19(2,3)16-11-17-14(10-18(16)25-26-22)8-9-21(17)27(23,24)15-6-4-13(12-20)5-7-15/h4-7,10-11,22H,8-9H2,1-3H3 |
| InChIKey | OBHWTGRHUGORRE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|