C20H23NO4S2 — CID 22572741
6-tert-butyl-5-(4-methylphenyl)sulfonylsulfanyl-2,3-dihydroindole-1-carboxylic acid (PubChem CID 22572741) has the molecular formula C20H23NO4S2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 6-tert-butyl-5-(4-methylphenyl)sulfonylsulfanyl-2,3-dihydroindole-1-carboxylic acid.
| Compound Name | 6-tert-butyl-5-(4-methylphenyl)sulfonylsulfanyl-2,3-dihydroindole-1-carboxylic acid |
|---|---|
| PubChem CID | 22572741 |
| Molecular Formula | C20H23NO4S2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 6-tert-butyl-5-(4-methylphenyl)sulfonylsulfanyl-2,3-dihydroindole-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)Sc2cc3c(cc2C(C)(C)C)N(C(=O)O)CC3)cc1 |
| InChI | InChI=1S/C20H23NO4S2/c1-13-5-7-15(8-6-13)27(24,25)26-18-11-14-9-10-21(19(22)23)17(14)12-16(18)20(2,3)4/h5-8,11-12H,9-10H2,1-4H3,(H,22,23) |
| InChIKey | WIHRFQLJEGQBTR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|