C13H17NO2S — CID 22572797
6-tert-butyl-5-sulfanyl-2,3-dihydroindole-1-carboxylic acid (PubChem CID 22572797) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 6-tert-butyl-5-sulfanyl-2,3-dihydroindole-1-carboxylic acid.
| Compound Name | 6-tert-butyl-5-sulfanyl-2,3-dihydroindole-1-carboxylic acid |
|---|---|
| PubChem CID | 22572797 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 6-tert-butyl-5-sulfanyl-2,3-dihydroindole-1-carboxylic acid |
| SMILES | CC(C)(C)c1cc2c(cc1S)CCN2C(=O)O |
| InChI | InChI=1S/C13H17NO2S/c1-13(2,3)9-7-10-8(6-11(9)17)4-5-14(10)12(15)16/h6-7,17H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | MROAUNOWOBPFRA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|