C10H9F2NO3 — CID 170431060
6-(difluoromethoxy)-2,3-dihydroindole-1-carboxylic acid (PubChem CID 170431060) has the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. Its IUPAC name is 6-(difluoromethoxy)-2,3-dihydroindole-1-carboxylic acid.
| Compound Name | 6-(difluoromethoxy)-2,3-dihydroindole-1-carboxylic acid |
|---|---|
| PubChem CID | 170431060 |
| Molecular Formula | C10H9F2NO3 |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 6-(difluoromethoxy)-2,3-dihydroindole-1-carboxylic acid |
| SMILES | O=C(O)N1CCc2ccc(OC(F)F)cc21 |
| InChI | InChI=1S/C10H9F2NO3/c11-9(12)16-7-2-1-6-3-4-13(10(14)15)8(6)5-7/h1-2,5,9H,3-4H2,(H,14,15) |
| InChIKey | QFHIYEKRENANKV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |