C18H14F2N2O4 — CID 55497148
(E)-3-[2-(difluoromethoxy)phenyl]-1-(6-nitro-2,3-dihydroindol-1-yl)prop-2-en-1-one (PubChem CID 55497148) has the molecular formula C18H14F2N2O4 and a molecular weight of 360.32 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-1-(6-nitro-2,3-dihydroindol-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-1-(6-nitro-2,3-dihydroindol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55497148 |
| Molecular Formula | C18H14F2N2O4 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-1-(6-nitro-2,3-dihydroindol-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1OC(F)F)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H14F2N2O4/c19-18(20)26-16-4-2-1-3-13(16)6-8-17(23)21-10-9-12-5-7-14(22(24)25)11-15(12)21/h1-8,11,18H,9-10H2/b8-6+ |
| InChIKey | VHIYHSKWBUNXGV-SOFGYWHQSA-N |
| XLogP | 3.80 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|