C21H19F2NO4 — CID 42975764
[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 42975764) has the molecular formula C21H19F2NO4 and a molecular weight of 387.38 g/mol. Its IUPAC name is [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42975764 |
| Molecular Formula | C21H19F2NO4 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccc(OC(F)F)cc1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H19F2NO4/c1-14(20(26)24-13-12-16-4-2-3-5-18(16)24)27-19(25)11-8-15-6-9-17(10-7-15)28-21(22)23/h2-11,14,21H,12-13H2,1H3/b11-8+ |
| InChIKey | ZVAWZLVGXWFJRR-DHZHZOJOSA-N |
| XLogP | 3.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|