C21H25NO2 — CID 26075972
(2S)-2-(4-tert-butylphenoxy)-1-(2,3-dihydroindol-1-yl)propan-1-one (PubChem CID 26075972) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (2S)-2-(4-tert-butylphenoxy)-1-(2,3-dihydroindol-1-yl)propan-1-one.
| Compound Name | (2S)-2-(4-tert-butylphenoxy)-1-(2,3-dihydroindol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 26075972 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (2S)-2-(4-tert-butylphenoxy)-1-(2,3-dihydroindol-1-yl)propan-1-one |
| SMILES | C[C@H](Oc1ccc(C(C)(C)C)cc1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H25NO2/c1-15(24-18-11-9-17(10-12-18)21(2,3)4)20(23)22-14-13-16-7-5-6-8-19(16)22/h5-12,15H,13-14H2,1-4H3/t15-/m0/s1 |
| InChIKey | GPAQXEJCOUSFSK-HNNXBMFYSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |