C20H17ClFNO3 — CID 7880850
[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (PubChem CID 7880850) has the molecular formula C20H17ClFNO3 and a molecular weight of 373.81 g/mol. Its IUPAC name is [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7880850 |
| Molecular Formula | C20H17ClFNO3 |
| Molecular Weight | 373.81 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccc(F)c(Cl)c1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H17ClFNO3/c1-13(20(25)23-11-10-15-4-2-3-5-18(15)23)26-19(24)9-7-14-6-8-17(22)16(21)12-14/h2-9,12-13H,10-11H2,1H3/b9-7+/t13-/m1/s1 |
| InChIKey | VQBHDEDQRHEOBZ-BUUCAEBMSA-N |
| XLogP | 4.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|