C19H15N3O3S — CID 146524262
1-(4-methyl-2-oxidoisoquinolin-2-ium-5-yl)sulfonyl-2,3-dihydroindole-6-carbonitrile (PubChem CID 146524262) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is 1-(4-methyl-2-oxidoisoquinolin-2-ium-5-yl)sulfonyl-2,3-dihydroindole-6-carbonitrile.
| Compound Name | 1-(4-methyl-2-oxidoisoquinolin-2-ium-5-yl)sulfonyl-2,3-dihydroindole-6-carbonitrile |
|---|---|
| PubChem CID | 146524262 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1-(4-methyl-2-oxidoisoquinolin-2-ium-5-yl)sulfonyl-2,3-dihydroindole-6-carbonitrile |
| SMILES | Cc1c[n+]([O-])cc2cccc(S(=O)(=O)N3CCc4ccc(C#N)cc43)c12 |
| InChI | InChI=1S/C19H15N3O3S/c1-13-11-21(23)12-16-3-2-4-18(19(13)16)26(24,25)22-8-7-15-6-5-14(10-20)9-17(15)22/h2-6,9,11-12H,7-8H2,1H3 |
| InChIKey | ZLXNZDIZSVGYJY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 88.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|