C20H17N3O3S — CID 164740954
5-[(6-isocyano-4-methyl-2,3-dihydroindol-1-yl)sulfonyl]-4-methyl-2-oxidoisoquinolin-2-ium (PubChem CID 164740954) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is 5-[(6-isocyano-4-methyl-2,3-dihydroindol-1-yl)sulfonyl]-4-methyl-2-oxidoisoquinolin-2-ium.
| Compound Name | 5-[(6-isocyano-4-methyl-2,3-dihydroindol-1-yl)sulfonyl]-4-methyl-2-oxidoisoquinolin-2-ium |
|---|---|
| PubChem CID | 164740954 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 5-[(6-isocyano-4-methyl-2,3-dihydroindol-1-yl)sulfonyl]-4-methyl-2-oxidoisoquinolin-2-ium |
| SMILES | [C-]#[N+]c1cc(C)c2c(c1)N(S(=O)(=O)c1cccc3c[n+]([O-])cc(C)c13)CC2 |
| InChI | InChI=1S/C20H17N3O3S/c1-13-9-16(21-3)10-18-17(13)7-8-23(18)27(25,26)19-6-4-5-15-12-22(24)11-14(2)20(15)19/h4-6,9-12H,7-8H2,1-2H3 |
| InChIKey | PFPNKNISDSSFLN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|