C21H17N3O3S — CID 153490360
5-[(4-cyclopropyl-6-isocyano-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one (PubChem CID 153490360) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is 5-[(4-cyclopropyl-6-isocyano-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one.
| Compound Name | 5-[(4-cyclopropyl-6-isocyano-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 153490360 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 5-[(4-cyclopropyl-6-isocyano-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one |
| SMILES | [C-]#[N+]c1cc(C2CC2)c2c(c1)N(S(=O)(=O)c1cccc3c(=O)[nH]ccc13)CC2 |
| InChI | InChI=1S/C21H17N3O3S/c1-22-14-11-18(13-5-6-13)15-8-10-24(19(15)12-14)28(26,27)20-4-2-3-17-16(20)7-9-23-21(17)25/h2-4,7,9,11-13H,5-6,8,10H2,(H,23,25) |
| InChIKey | NJDAKOPGJDDTHW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|