C17H19N3O3S — CID 146621173
5-spiro[1,2,3,3a,4,6a-hexahydropyrrolo[3,4-b]pyrrole-6,1'-cyclopropane]-5-ylsulfonyl-2H-isoquinolin-1-one (PubChem CID 146621173) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 5-spiro[1,2,3,3a,4,6a-hexahydropyrrolo[3,4-b]pyrrole-6,1'-cyclopropane]-5-ylsulfonyl-2H-isoquinolin-1-one.
| Compound Name | 5-spiro[1,2,3,3a,4,6a-hexahydropyrrolo[3,4-b]pyrrole-6,1'-cyclopropane]-5-ylsulfonyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 146621173 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 5-spiro[1,2,3,3a,4,6a-hexahydropyrrolo[3,4-b]pyrrole-6,1'-cyclopropane]-5-ylsulfonyl-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]ccc2c(S(=O)(=O)N3CC4CCNC4C34CC4)cccc12 |
| InChI | InChI=1S/C17H19N3O3S/c21-16-13-2-1-3-14(12(13)5-9-19-16)24(22,23)20-10-11-4-8-18-15(11)17(20)6-7-17/h1-3,5,9,11,15,18H,4,6-8,10H2,(H,19,21) |
| InChIKey | CJVSBDVFJGLPPU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |