C18H13ClN4O3S — CID 146524238
4-amino-1-[(4-chloro-1-oxo-2H-isoquinolin-5-yl)sulfonyl]-2,3-dihydroindole-6-carbonitrile (PubChem CID 146524238) has the molecular formula C18H13ClN4O3S and a molecular weight of 400.85 g/mol. Its IUPAC name is 4-amino-1-[(4-chloro-1-oxo-2H-isoquinolin-5-yl)sulfonyl]-2,3-dihydroindole-6-carbonitrile.
| Compound Name | 4-amino-1-[(4-chloro-1-oxo-2H-isoquinolin-5-yl)sulfonyl]-2,3-dihydroindole-6-carbonitrile |
|---|---|
| PubChem CID | 146524238 |
| Molecular Formula | C18H13ClN4O3S |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 4-amino-1-[(4-chloro-1-oxo-2H-isoquinolin-5-yl)sulfonyl]-2,3-dihydroindole-6-carbonitrile |
| SMILES | N#Cc1cc(N)c2c(c1)N(S(=O)(=O)c1cccc3c(=O)[nH]cc(Cl)c13)CC2 |
| InChI | InChI=1S/C18H13ClN4O3S/c19-13-9-22-18(24)12-2-1-3-16(17(12)13)27(25,26)23-5-4-11-14(21)6-10(8-20)7-15(11)23/h1-3,6-7,9H,4-5,21H2,(H,22,24) |
| InChIKey | RUYIDRGITHKTKM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|