C14H11N3O2S — CID 106545109
3-(2,3-dihydroindol-1-ylsulfonyl)pyridine-2-carbonitrile (PubChem CID 106545109) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)pyridine-2-carbonitrile.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 106545109 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1S(=O)(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C14H11N3O2S/c15-10-12-14(6-3-8-16-12)20(18,19)17-9-7-11-4-1-2-5-13(11)17/h1-6,8H,7,9H2 |
| InChIKey | DXYQQYKYZUHQNN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |