C12H15N3O3S — CID 106545672
3-(3,3-dimethylmorpholin-4-yl)sulfonylpyridine-2-carbonitrile (PubChem CID 106545672) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-(3,3-dimethylmorpholin-4-yl)sulfonylpyridine-2-carbonitrile.
| Compound Name | 3-(3,3-dimethylmorpholin-4-yl)sulfonylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 106545672 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-(3,3-dimethylmorpholin-4-yl)sulfonylpyridine-2-carbonitrile |
| SMILES | CC1(C)COCCN1S(=O)(=O)c1cccnc1C#N |
| InChI | InChI=1S/C12H15N3O3S/c1-12(2)9-18-7-6-15(12)19(16,17)11-4-3-5-14-10(11)8-13/h3-5H,6-7,9H2,1-2H3 |
| InChIKey | YEHIDRKTDIPTMD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |