C15H19N3O2S — CID 106546619
3-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyridine-2-carbonitrile (PubChem CID 106546619) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 106546619 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyridine-2-carbonitrile |
| SMILES | CC(C)(C)C1=CCN(S(=O)(=O)c2cccnc2C#N)CC1 |
| InChI | InChI=1S/C15H19N3O2S/c1-15(2,3)12-6-9-18(10-7-12)21(19,20)14-5-4-8-17-13(14)11-16/h4-6,8H,7,9-10H2,1-3H3 |
| InChIKey | PVTHCRVUNBQTHV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|