C16H20N2O3S — CID 154789646
3,3-dimethyl-4-(quinolin-8-ylmethylsulfonyl)morpholine (PubChem CID 154789646) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 3,3-dimethyl-4-(quinolin-8-ylmethylsulfonyl)morpholine.
| Compound Name | 3,3-dimethyl-4-(quinolin-8-ylmethylsulfonyl)morpholine |
|---|---|
| PubChem CID | 154789646 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3,3-dimethyl-4-(quinolin-8-ylmethylsulfonyl)morpholine |
| SMILES | CC1(C)COCCN1S(=O)(=O)Cc1cccc2cccnc12 |
| InChI | InChI=1S/C16H20N2O3S/c1-16(2)12-21-10-9-18(16)22(19,20)11-14-6-3-5-13-7-4-8-17-15(13)14/h3-8H,9-12H2,1-2H3 |
| InChIKey | MNTJQIWFQNWBQA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |