C14H10Cl3NO2S — CID 50876146
1-(2,3,4-trichlorophenyl)sulfonyl-2,3-dihydroindole (PubChem CID 50876146) has the molecular formula C14H10Cl3NO2S and a molecular weight of 362.67 g/mol. Its IUPAC name is 1-(2,3,4-trichlorophenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | 1-(2,3,4-trichlorophenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 50876146 |
| Molecular Formula | C14H10Cl3NO2S |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | 1-(2,3,4-trichlorophenyl)sulfonyl-2,3-dihydroindole |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1Cl)N1CCc2ccccc21 |
| InChI | InChI=1S/C14H10Cl3NO2S/c15-10-5-6-12(14(17)13(10)16)21(19,20)18-8-7-9-3-1-2-4-11(9)18/h1-6H,7-8H2 |
| InChIKey | LKEJGBLAVGHLGA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|