C17H21N3O2S — CID 42282733
1-(1-cyclopentyl-3-methylpyrazol-4-yl)sulfonyl-2,3-dihydroindole (PubChem CID 42282733) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-(1-cyclopentyl-3-methylpyrazol-4-yl)sulfonyl-2,3-dihydroindole.
| Compound Name | 1-(1-cyclopentyl-3-methylpyrazol-4-yl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 42282733 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-(1-cyclopentyl-3-methylpyrazol-4-yl)sulfonyl-2,3-dihydroindole |
| SMILES | Cc1nn(C2CCCC2)cc1S(=O)(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H21N3O2S/c1-13-17(12-19(18-13)15-7-3-4-8-15)23(21,22)20-11-10-14-6-2-5-9-16(14)20/h2,5-6,9,12,15H,3-4,7-8,10-11H2,1H3 |
| InChIKey | CXBLOMAOHZJSII-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |