C17H17NO3S — CID 174519680
2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]propanal (PubChem CID 174519680) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]propanal.
| Compound Name | 2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]propanal |
|---|---|
| PubChem CID | 174519680 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]propanal |
| SMILES | CC(C=O)c1ccc2c(c1)CCN2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17NO3S/c1-13(12-19)14-7-8-17-15(11-14)9-10-18(17)22(20,21)16-5-3-2-4-6-16/h2-8,11-13H,9-10H2,1H3 |
| InChIKey | ALETXCGSPIBGIB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|