C19H21N3O3S — CID 110640995
5-[4-(benzenesulfonyl)piperazin-1-yl]-1-methyl-3H-indol-2-one (PubChem CID 110640995) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 5-[4-(benzenesulfonyl)piperazin-1-yl]-1-methyl-3H-indol-2-one.
| Compound Name | 5-[4-(benzenesulfonyl)piperazin-1-yl]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 110640995 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 5-[4-(benzenesulfonyl)piperazin-1-yl]-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(N3CCN(S(=O)(=O)c4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C19H21N3O3S/c1-20-18-8-7-16(13-15(18)14-19(20)23)21-9-11-22(12-10-21)26(24,25)17-5-3-2-4-6-17/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | KYKCZFIXEFCABU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|