C23H18ClF3N6O4S — CID 162622776
1-(3-chlorophenyl)sulfonyl-2,3-dihydroindole-6-carboxylic acid;4-(2H-tetrazol-5-yl)-3-(trifluoromethyl)aniline (PubChem CID 162622776) has the molecular formula C23H18ClF3N6O4S and a molecular weight of 566.95 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-2,3-dihydroindole-6-carboxylic acid;4-(2H-tetrazol-5-yl)-3-(trifluoromethyl)aniline.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-2,3-dihydroindole-6-carboxylic acid;4-(2H-tetrazol-5-yl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 162622776 |
| Molecular Formula | C23H18ClF3N6O4S |
| Molecular Weight | 566.95 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-2,3-dihydroindole-6-carboxylic acid;4-(2H-tetrazol-5-yl)-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(-c2nn[nH]n2)c(C(F)(F)F)c1.O=C(O)c1ccc2c(c1)N(S(=O)(=O)c1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C15H12ClNO4S.C8H6F3N5/c16-12-2-1-3-13(9-12)22(20,21)17-7-6-10-4-5-11(15(18)19)8-14(10)17;9-8(10,11)6-3-4(12)1-2-5(6)7-13-15-16-14-7/h1-5,8-9H,6-7H2,(H,18,19);1-3H,12H2,(H,13,14,15,16) |
| InChIKey | KBUAQNYWBQMLJG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.95 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|