About ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate
ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate (PubChem CID 114461698) has the molecular formula C12H17N3O4S
and a molecular weight of 299.35 g/mol. Its IUPAC name is ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate |
| PubChem CID | 114461698 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCCc2ccc(N)cc21 |
| InChI | InChI=1S/C12H17N3O4S/c1-2-19-12(16)14-20(17,18)15-7-3-4-9-5-6-10(13)8-11(9)15/h5-6,8H,2-4,7,13H2,1H3,(H,14,16) |
| InChIKey | OTTPUWOQGCWHIT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate?
The IUPAC name of ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate (CID 114461698) is ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate.
What is the SMILES notation for ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate?
The canonical SMILES for ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate is CCOC(=O)NS(=O)(=O)N1CCCc2ccc(N)cc21.
What is the InChIKey of ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate?
The InChIKey is OTTPUWOQGCWHIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4S/c1-2-19-12(16)14-20(17,18)15-7-3-4-9-5-6-10(13)8-11(9)15/h5-6,8H,2-4,7,13H2,1H3,(H,14,16).
What are the key properties of ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate?
ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate has a molecular weight of 299.35 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(7-amino-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]carbamate is sourced from PubChem (CID 114461698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).