C18H19ClN2O4S — CID 58794318
ethyl N-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]carbamate (PubChem CID 58794318) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is ethyl N-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]carbamate.
| Compound Name | ethyl N-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]carbamate |
|---|---|
| PubChem CID | 58794318 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | ethyl N-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(S(=O)(=O)N2CCCc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C18H19ClN2O4S/c1-2-25-18(22)20-16-12-14(9-10-15(16)19)26(23,24)21-11-5-7-13-6-3-4-8-17(13)21/h3-4,6,8-10,12H,2,5,7,11H2,1H3,(H,20,22) |
| InChIKey | UQEAAWUQQQKKNS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |