C12H19N3O2S — CID 114804730
7-amino-N-propyl-3,4-dihydro-2H-quinoline-1-sulfonamide (PubChem CID 114804730) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 7-amino-N-propyl-3,4-dihydro-2H-quinoline-1-sulfonamide.
| Compound Name | 7-amino-N-propyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
|---|---|
| PubChem CID | 114804730 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 7-amino-N-propyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
| SMILES | CCCNS(=O)(=O)N1CCCc2ccc(N)cc21 |
| InChI | InChI=1S/C12H19N3O2S/c1-2-7-14-18(16,17)15-8-3-4-10-5-6-11(13)9-12(10)15/h5-6,9,14H,2-4,7-8,13H2,1H3 |
| InChIKey | FGPXYMUWZHVBIS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|