C16H14FNO4S — CID 110635382
1-(4-fluorophenyl)sulfonyl-8-methoxy-2,3-dihydroquinolin-4-one (PubChem CID 110635382) has the molecular formula C16H14FNO4S and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-8-methoxy-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-8-methoxy-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110635382 |
| Molecular Formula | C16H14FNO4S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-8-methoxy-2,3-dihydroquinolin-4-one |
| SMILES | COc1cccc2c1N(S(=O)(=O)c1ccc(F)cc1)CCC2=O |
| InChI | InChI=1S/C16H14FNO4S/c1-22-15-4-2-3-13-14(19)9-10-18(16(13)15)23(20,21)12-7-5-11(17)6-8-12/h2-8H,9-10H2,1H3 |
| InChIKey | ZFOJFEKTVCDKOM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |