C14H13NO4S2 — CID 110635402
8-methoxy-1-thiophen-2-ylsulfonyl-2,3-dihydroquinolin-4-one (PubChem CID 110635402) has the molecular formula C14H13NO4S2 and a molecular weight of 323.39 g/mol. Its IUPAC name is 8-methoxy-1-thiophen-2-ylsulfonyl-2,3-dihydroquinolin-4-one.
| Compound Name | 8-methoxy-1-thiophen-2-ylsulfonyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110635402 |
| Molecular Formula | C14H13NO4S2 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 8-methoxy-1-thiophen-2-ylsulfonyl-2,3-dihydroquinolin-4-one |
| SMILES | COc1cccc2c1N(S(=O)(=O)c1cccs1)CCC2=O |
| InChI | InChI=1S/C14H13NO4S2/c1-19-12-5-2-4-10-11(16)7-8-15(14(10)12)21(17,18)13-6-3-9-20-13/h2-6,9H,7-8H2,1H3 |
| InChIKey | XIPJYHNKXRMXMW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |