C18H19ClN2O3S — CID 51130845
1-[3-(3-chlorophenyl)propanoyl]-N-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 51130845) has the molecular formula C18H19ClN2O3S and a molecular weight of 378.88 g/mol. Its IUPAC name is 1-[3-(3-chlorophenyl)propanoyl]-N-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[3-(3-chlorophenyl)propanoyl]-N-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 51130845 |
| Molecular Formula | C18H19ClN2O3S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1-[3-(3-chlorophenyl)propanoyl]-N-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)CCN2C(=O)CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O3S/c1-20-25(23,24)16-6-7-17-14(12-16)9-10-21(17)18(22)8-5-13-3-2-4-15(19)11-13/h2-4,6-7,11-12,20H,5,8-10H2,1H3 |
| InChIKey | FCPWUZGQIDDFCH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |