C12H17N3O3S — CID 119305331
1-[(2S)-2-aminopropanoyl]-N-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 119305331) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 1-[(2S)-2-aminopropanoyl]-N-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[(2S)-2-aminopropanoyl]-N-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 119305331 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-[(2S)-2-aminopropanoyl]-N-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)CCN2C(=O)[C@H](C)N |
| InChI | InChI=1S/C12H17N3O3S/c1-8(13)12(16)15-6-5-9-7-10(3-4-11(9)15)19(17,18)14-2/h3-4,7-8,14H,5-6,13H2,1-2H3/t8-/m0/s1 |
| InChIKey | XTRJRRYCQGOYOK-QMMMGPOBSA-N |
| XLogP | -0.17 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |