C21H22IN5O3 — CID 22597847
tert-butyl 7-[(4-azidobenzoyl)amino]-5-iodo-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 22597847) has the molecular formula C21H22IN5O3 and a molecular weight of 519.34 g/mol. Its IUPAC name is tert-butyl 7-[(4-azidobenzoyl)amino]-5-iodo-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 7-[(4-azidobenzoyl)amino]-5-iodo-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 22597847 |
| Molecular Formula | C21H22IN5O3 |
| Molecular Weight | 519.34 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | tert-butyl 7-[(4-azidobenzoyl)amino]-5-iodo-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(I)cc(NC(=O)c3ccc(N=[N+]=[N-])cc3)cc2C1 |
| InChI | InChI=1S/C21H22IN5O3/c1-21(2,3)30-20(29)27-9-8-17-14(12-27)10-16(11-18(17)22)24-19(28)13-4-6-15(7-5-13)25-26-23/h4-7,10-11H,8-9,12H2,1-3H3,(H,24,28) |
| InChIKey | HANAXEWRZIUBJG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.34 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|