C14H18N4O2 — CID 150502079
tert-butyl 8-azido-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 150502079) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is tert-butyl 8-azido-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 8-azido-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 150502079 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | tert-butyl 8-azido-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cccc(N=[N+]=[N-])c2C1 |
| InChI | InChI=1S/C14H18N4O2/c1-14(2,3)20-13(19)18-8-7-10-5-4-6-12(16-17-15)11(10)9-18/h4-6H,7-9H2,1-3H3 |
| InChIKey | HYAKHZCPFYHNCZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|