C12H11FN4O4 — CID 104699097
methyl 5-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-fluoro-4-nitrobenzoate (PubChem CID 104699097) has the molecular formula C12H11FN4O4 and a molecular weight of 294.24 g/mol. Its IUPAC name is methyl 5-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-fluoro-4-nitrobenzoate.
| Compound Name | methyl 5-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-fluoro-4-nitrobenzoate |
|---|---|
| PubChem CID | 104699097 |
| Molecular Formula | C12H11FN4O4 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | methyl 5-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-fluoro-4-nitrobenzoate |
| SMILES | COC(=O)c1cc(-n2nc(C)nc2C)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H11FN4O4/c1-6-14-7(2)16(15-6)10-4-8(12(18)21-3)9(13)5-11(10)17(19)20/h4-5H,1-3H3 |
| InChIKey | KNFCXVAIVKCWNX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|