C16H23BrN4O5S — CID 55681190
4-[4-(4-bromo-2-nitrophenyl)piperazin-1-yl]sulfonyl-2,6-dimethylmorpholine (PubChem CID 55681190) has the molecular formula C16H23BrN4O5S and a molecular weight of 463.35 g/mol. Its IUPAC name is 4-[4-(4-bromo-2-nitrophenyl)piperazin-1-yl]sulfonyl-2,6-dimethylmorpholine.
| Compound Name | 4-[4-(4-bromo-2-nitrophenyl)piperazin-1-yl]sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 55681190 |
| Molecular Formula | C16H23BrN4O5S |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 4-[4-(4-bromo-2-nitrophenyl)piperazin-1-yl]sulfonyl-2,6-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)N2CCN(c3ccc(Br)cc3[N+](=O)[O-])CC2)CC(C)O1 |
| InChI | InChI=1S/C16H23BrN4O5S/c1-12-10-20(11-13(2)26-12)27(24,25)19-7-5-18(6-8-19)15-4-3-14(17)9-16(15)21(22)23/h3-4,9,12-13H,5-8,10-11H2,1-2H3 |
| InChIKey | QKXSGEBGYRRDSS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|