C20H32N6O4 — CID 123688151
tert-butyl N-[(1R,2R)-2-[(5-nitropyrimidin-2-yl)-[(3S)-piperidin-3-yl]amino]cyclohexyl]carbamate (PubChem CID 123688151) has the molecular formula C20H32N6O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-2-[(5-nitropyrimidin-2-yl)-[(3S)-piperidin-3-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-2-[(5-nitropyrimidin-2-yl)-[(3S)-piperidin-3-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 123688151 |
| Molecular Formula | C20H32N6O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | tert-butyl N-[(1R,2R)-2-[(5-nitropyrimidin-2-yl)-[(3S)-piperidin-3-yl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1N(c1ncc([N+](=O)[O-])cn1)[C@H]1CCCNC1 |
| InChI | InChI=1S/C20H32N6O4/c1-20(2,3)30-19(27)24-16-8-4-5-9-17(16)25(14-7-6-10-21-11-14)18-22-12-15(13-23-18)26(28)29/h12-14,16-17,21H,4-11H2,1-3H3,(H,24,27)/t14-,16+,17+/m0/s1 |
| InChIKey | VKJUHBAPFGHMHG-USXIJHARSA-N |
| XLogP | 2.78 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|