C28H34N4O3 — CID 123519044
benzyl N-[(1R,2R)-2-[4-(1,3-oxazol-2-yl)-N-[(3S)-piperidin-3-yl]anilino]cyclohexyl]carbamate (PubChem CID 123519044) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is benzyl N-[(1R,2R)-2-[4-(1,3-oxazol-2-yl)-N-[(3S)-piperidin-3-yl]anilino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[(1R,2R)-2-[4-(1,3-oxazol-2-yl)-N-[(3S)-piperidin-3-yl]anilino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 123519044 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | benzyl N-[(1R,2R)-2-[4-(1,3-oxazol-2-yl)-N-[(3S)-piperidin-3-yl]anilino]cyclohexyl]carbamate |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1N(c1ccc(-c2ncco2)cc1)[C@H]1CCCNC1)OCc1ccccc1 |
| InChI | InChI=1S/C28H34N4O3/c33-28(35-20-21-7-2-1-3-8-21)31-25-10-4-5-11-26(25)32(24-9-6-16-29-19-24)23-14-12-22(13-15-23)27-30-17-18-34-27/h1-3,7-8,12-15,17-18,24-26,29H,4-6,9-11,16,19-20H2,(H,31,33)/t24-,25+,26+/m0/s1 |
| InChIKey | HFKVEFYOFMBOIO-JIMJEQGWSA-N |
| XLogP | 5.14 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|