C20H31N3O3 — CID 66564953
benzyl N-[2-[[(2S)-2-amino-3-methylbutanoyl]-methylamino]cyclohexyl]carbamate (PubChem CID 66564953) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is benzyl N-[2-[[(2S)-2-amino-3-methylbutanoyl]-methylamino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[2-[[(2S)-2-amino-3-methylbutanoyl]-methylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 66564953 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | benzyl N-[2-[[(2S)-2-amino-3-methylbutanoyl]-methylamino]cyclohexyl]carbamate |
| SMILES | CC(C)[C@H](N)C(=O)N(C)C1CCCCC1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H31N3O3/c1-14(2)18(21)19(24)23(3)17-12-8-7-11-16(17)22-20(25)26-13-15-9-5-4-6-10-15/h4-6,9-10,14,16-18H,7-8,11-13,21H2,1-3H3,(H,22,25)/t16?,17?,18-/m0/s1 |
| InChIKey | NVXKATFIIOIHNA-ABHNRTSZSA-N |
| XLogP | 2.67 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |