C19H27ClN2O3 — CID 96552577
benzyl N-[(1S,2R)-2-[(2-chloroacetyl)-propan-2-ylamino]cyclohexyl]carbamate (PubChem CID 96552577) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is benzyl N-[(1S,2R)-2-[(2-chloroacetyl)-propan-2-ylamino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,2R)-2-[(2-chloroacetyl)-propan-2-ylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 96552577 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | benzyl N-[(1S,2R)-2-[(2-chloroacetyl)-propan-2-ylamino]cyclohexyl]carbamate |
| SMILES | CC(C)N(C(=O)CCl)[C@@H]1CCCC[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27ClN2O3/c1-14(2)22(18(23)12-20)17-11-7-6-10-16(17)21-19(24)25-13-15-8-4-3-5-9-15/h3-5,8-9,14,16-17H,6-7,10-13H2,1-2H3,(H,21,24)/t16-,17+/m0/s1 |
| InChIKey | ZCWLYRNUEUDMNZ-DLBZAZTESA-N |
| XLogP | 3.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|