C26H34N4O4 — CID 123360744
benzyl N-[(1R,2R)-2-(N-[(3S)-3-methylpiperidin-3-yl]-4-nitroanilino)cyclohexyl]carbamate (PubChem CID 123360744) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is benzyl N-[(1R,2R)-2-(N-[(3S)-3-methylpiperidin-3-yl]-4-nitroanilino)cyclohexyl]carbamate.
| Compound Name | benzyl N-[(1R,2R)-2-(N-[(3S)-3-methylpiperidin-3-yl]-4-nitroanilino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 123360744 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | benzyl N-[(1R,2R)-2-(N-[(3S)-3-methylpiperidin-3-yl]-4-nitroanilino)cyclohexyl]carbamate |
| SMILES | C[C@]1(N(c2ccc([N+](=O)[O-])cc2)[C@@H]2CCCC[C@H]2NC(=O)OCc2ccccc2)CCCNC1 |
| InChI | InChI=1S/C26H34N4O4/c1-26(16-7-17-27-19-26)29(21-12-14-22(15-13-21)30(32)33)24-11-6-5-10-23(24)28-25(31)34-18-20-8-3-2-4-9-20/h2-4,8-9,12-15,23-24,27H,5-7,10-11,16-19H2,1H3,(H,28,31)/t23-,24-,26+/m1/s1 |
| InChIKey | UQGWBOFMSZYIOE-MZKUHISZSA-N |
| XLogP | 4.78 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|