C17H24N2O6 — CID 69014681
[5,5-dimethoxy-2-(phenylmethoxycarbonylamino)cyclohexyl]carbamic acid (PubChem CID 69014681) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is [5,5-dimethoxy-2-(phenylmethoxycarbonylamino)cyclohexyl]carbamic acid.
| Compound Name | [5,5-dimethoxy-2-(phenylmethoxycarbonylamino)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 69014681 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [5,5-dimethoxy-2-(phenylmethoxycarbonylamino)cyclohexyl]carbamic acid |
| SMILES | COC1(OC)CCC(NC(=O)OCc2ccccc2)C(NC(=O)O)C1 |
| InChI | InChI=1S/C17H24N2O6/c1-23-17(24-2)9-8-13(14(10-17)18-15(20)21)19-16(22)25-11-12-6-4-3-5-7-12/h3-7,13-14,18H,8-11H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | CMCUGJARWSEGMS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|