C10H18BrNO4S2 — CID 80661845
N-(2-bromocyclopentyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 80661845) has the molecular formula C10H18BrNO4S2 and a molecular weight of 360.30 g/mol. Its IUPAC name is N-(2-bromocyclopentyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(2-bromocyclopentyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 80661845 |
| Molecular Formula | C10H18BrNO4S2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | N-(2-bromocyclopentyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NC2CCCC2Br)CC1 |
| InChI | InChI=1S/C10H18BrNO4S2/c11-9-2-1-3-10(9)12-18(15,16)8-4-6-17(13,14)7-5-8/h8-10,12H,1-7H2 |
| InChIKey | QCZXZMNAJZWRFG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|