C10H19NO5S2 — CID 83229588
N-cyclopentyloxy-1,1-dioxothiane-4-sulfonamide (PubChem CID 83229588) has the molecular formula C10H19NO5S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-cyclopentyloxy-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-cyclopentyloxy-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 83229588 |
| Molecular Formula | C10H19NO5S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-cyclopentyloxy-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NOC2CCCC2)CC1 |
| InChI | InChI=1S/C10H19NO5S2/c12-17(13)7-5-10(6-8-17)18(14,15)11-16-9-3-1-2-4-9/h9-11H,1-8H2 |
| InChIKey | AQPMIRBVIAWGQK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|