C20H33IN4O3S — CID 111172542
N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-(4-phenylbutan-2-ylamino)methylidene]amino]propanamide;hydroiodide (PubChem CID 111172542) has the molecular formula C20H33IN4O3S and a molecular weight of 536.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-(4-phenylbutan-2-ylamino)methylidene]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-(4-phenylbutan-2-ylamino)methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111172542 |
| Molecular Formula | C20H33IN4O3S |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-(4-phenylbutan-2-ylamino)methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)NC(C)CCc1ccccc1.I |
| InChI | InChI=1S/C20H32N4O3S.HI/c1-3-21-20(23-16(2)9-10-17-7-5-4-6-8-17)22-13-11-19(25)24-18-12-14-28(26,27)15-18;/h4-8,16,18H,3,9-15H2,1-2H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | MKCGTRMZRBOEBF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|