C18H28FIN4O3S — CID 111285600
N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]propanamide;hydroiodide (PubChem CID 111285600) has the molecular formula C18H28FIN4O3S and a molecular weight of 526.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111285600 |
| Molecular Formula | C18H28FIN4O3S |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C18H27FN4O3S.HI/c1-3-20-18(23(2)12-14-5-4-6-15(19)11-14)21-9-7-17(24)22-16-8-10-27(25,26)13-16;/h4-6,11,16H,3,7-10,12-13H2,1-2H3,(H,20,21)(H,22,24);1H |
| InChIKey | VVRGCUUFFBVPBP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|