C19H30N4O3S — CID 111289311
N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[methyl-[(4-methylphenyl)methyl]amino]methylidene]amino]propanamide (PubChem CID 111289311) has the molecular formula C19H30N4O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[methyl-[(4-methylphenyl)methyl]amino]methylidene]amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[methyl-[(4-methylphenyl)methyl]amino]methylidene]amino]propanamide |
|---|---|
| PubChem CID | 111289311 |
| Molecular Formula | C19H30N4O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[methyl-[(4-methylphenyl)methyl]amino]methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)N(C)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C19H30N4O3S/c1-4-20-19(23(3)13-16-7-5-15(2)6-8-16)21-11-9-18(24)22-17-10-12-27(25,26)14-17/h5-8,17H,4,9-14H2,1-3H3,(H,20,21)(H,22,24) |
| InChIKey | JKVFNXJSPQIEOR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|