C12H16FNO2S — CID 43177596
N-[1-(2-fluorophenyl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 43177596) has the molecular formula C12H16FNO2S and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[1-(2-fluorophenyl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43177596 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-[1-(2-fluorophenyl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | CC(NC1CCS(=O)(=O)C1)c1ccccc1F |
| InChI | InChI=1S/C12H16FNO2S/c1-9(11-4-2-3-5-12(11)13)14-10-6-7-17(15,16)8-10/h2-5,9-10,14H,6-8H2,1H3 |
| InChIKey | VIJOQAXAOQLPLA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |