C10H14BrNO3S — CID 104651994
N-[1-(5-bromofuran-2-yl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 104651994) has the molecular formula C10H14BrNO3S and a molecular weight of 308.20 g/mol. Its IUPAC name is N-[1-(5-bromofuran-2-yl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[1-(5-bromofuran-2-yl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 104651994 |
| Molecular Formula | C10H14BrNO3S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | N-[1-(5-bromofuran-2-yl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | CC(NC1CCS(=O)(=O)C1)c1ccc(Br)o1 |
| InChI | InChI=1S/C10H14BrNO3S/c1-7(9-2-3-10(11)15-9)12-8-4-5-16(13,14)6-8/h2-3,7-8,12H,4-6H2,1H3 |
| InChIKey | SKUFEIYMUDBGFN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |