C10H15NO3S — CID 81402788
N-[(1R)-1-(furan-2-yl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 81402788) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 81402788 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | C[C@@H](NC1CCS(=O)(=O)C1)c1ccco1 |
| InChI | InChI=1S/C10H15NO3S/c1-8(10-3-2-5-14-10)11-9-4-6-15(12,13)7-9/h2-3,5,8-9,11H,4,6-7H2,1H3/t8-,9?/m1/s1 |
| InChIKey | FYNJSGOLMUEOGM-VEDVMXKPSA-N |
| XLogP | 1.12 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |