C9H14N2O2S2 — CID 115878917
1,1-dioxo-N-[1-(1,3-thiazol-4-yl)ethyl]thiolan-3-amine (PubChem CID 115878917) has the molecular formula C9H14N2O2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 1,1-dioxo-N-[1-(1,3-thiazol-4-yl)ethyl]thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-[1-(1,3-thiazol-4-yl)ethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 115878917 |
| Molecular Formula | C9H14N2O2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1,1-dioxo-N-[1-(1,3-thiazol-4-yl)ethyl]thiolan-3-amine |
| SMILES | CC(NC1CCS(=O)(=O)C1)c1cscn1 |
| InChI | InChI=1S/C9H14N2O2S2/c1-7(9-4-14-6-10-9)11-8-2-3-15(12,13)5-8/h4,6-8,11H,2-3,5H2,1H3 |
| InChIKey | GNLYPJCLWRAORN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |